C12H13NS — CID 81453544
(4S)-1,2,3,4-tetrahydrodibenzothiophen-4-amine (PubChem CID 81453544) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is (4S)-1,2,3,4-tetrahydrodibenzothiophen-4-amine.
| Compound Name | (4S)-1,2,3,4-tetrahydrodibenzothiophen-4-amine |
|---|---|
| PubChem CID | 81453544 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (4S)-1,2,3,4-tetrahydrodibenzothiophen-4-amine |
| SMILES | N[C@H]1CCCc2c1sc1ccccc21 |
| InChI | InChI=1S/C12H13NS/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-2,4,7,10H,3,5-6,13H2/t10-/m0/s1 |
| InChIKey | LUHLUIGXWJMMKG-JTQLQIEISA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |