C10H8N4O2 — CID 814544
3-amino-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 814544) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-amino-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-amino-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 814544 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-amino-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | Nn1c(=O)[nH]c2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C10H8N4O2/c11-14-9(15)8-7(13-10(14)16)5-3-1-2-4-6(5)12-8/h1-4,12H,11H2,(H,13,16) |
| InChIKey | WHYUSOORUMTYCQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |