C11H10N4O3 — CID 814546
3-amino-8-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 814546) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-amino-8-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-amino-8-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 814546 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-amino-8-methoxy-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2[nH]c3c(=O)n(N)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C11H10N4O3/c1-18-5-2-3-7-6(4-5)8-9(13-7)10(16)15(12)11(17)14-8/h2-4,13H,12H2,1H3,(H,14,17) |
| InChIKey | ZKZGPQUQFQLYJA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |