C16H15N3 — CID 81462631
11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-13-ylmethanamine (PubChem CID 81462631) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-13-ylmethanamine.
| Compound Name | 11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-13-ylmethanamine |
|---|---|
| PubChem CID | 81462631 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-13-ylmethanamine |
| SMILES | NCc1ccc2nc3c(n2c1)CCc1ccccc1-3 |
| InChI | InChI=1S/C16H15N3/c17-9-11-5-8-15-18-16-13-4-2-1-3-12(13)6-7-14(16)19(15)10-11/h1-5,8,10H,6-7,9,17H2 |
| InChIKey | VUEQZIGUOLUXAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |