C12H16F3NO — CID 81463154
3-amino-1-[3-(trifluoromethyl)phenyl]pentan-1-ol (PubChem CID 81463154) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-amino-1-[3-(trifluoromethyl)phenyl]pentan-1-ol.
| Compound Name | 3-amino-1-[3-(trifluoromethyl)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 81463154 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-amino-1-[3-(trifluoromethyl)phenyl]pentan-1-ol |
| SMILES | CCC(N)CC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO/c1-2-10(16)7-11(17)8-4-3-5-9(6-8)12(13,14)15/h3-6,10-11,17H,2,7,16H2,1H3 |
| InChIKey | HVGNOVQSXKDWBI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |