About 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole
5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole (PubChem CID 81463558) has the molecular formula C11H7F2N3S
and a molecular weight of 251.26 g/mol. Its IUPAC name is 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole |
| PubChem CID | 81463558 |
| Molecular Formula | C11H7F2N3S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1-c1nc2c(F)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C11H7F2N3S/c1-5-10(17-4-14-5)11-15-8-3-6(12)2-7(13)9(8)16-11/h2-4H,1H3,(H,15,16) |
| InChIKey | KZEZWJSFKBRQSX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole?
The IUPAC name of 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole (CID 81463558) is 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole?
The canonical SMILES for 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole is Cc1ncsc1-c1nc2c(F)cc(F)cc2[nH]1.
What is the InChIKey of 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole?
The InChIKey is KZEZWJSFKBRQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2N3S/c1-5-10(17-4-14-5)11-15-8-3-6(12)2-7(13)9(8)16-11/h2-4H,1H3,(H,15,16).
What are the key properties of 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole?
5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole has a molecular weight of 251.26 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,6-difluoro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole is sourced from PubChem (CID 81463558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).