C13H20IN3 — CID 81464187
1-(4-amino-2-iodophenyl)-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 81464187) has the molecular formula C13H20IN3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-(4-amino-2-iodophenyl)-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-(4-amino-2-iodophenyl)-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81464187 |
| Molecular Formula | C13H20IN3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-(4-amino-2-iodophenyl)-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | CC1CN(c2ccc(N)cc2I)CC1N(C)C |
| InChI | InChI=1S/C13H20IN3/c1-9-7-17(8-13(9)16(2)3)12-5-4-10(15)6-11(12)14/h4-6,9,13H,7-8,15H2,1-3H3 |
| InChIKey | GCOFWUXQNWONIZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|