About N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine
N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine (PubChem CID 81465823) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine.
Molecular Properties
| Compound Name | N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine |
| PubChem CID | 81465823 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine |
| SMILES | CC1CC(Nc2cnn(C)c2)CN1C |
| InChI | InChI=1S/C10H18N4/c1-8-4-9(6-13(8)2)12-10-5-11-14(3)7-10/h5,7-9,12H,4,6H2,1-3H3 |
| InChIKey | FFZMEVRTWVDJBV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine?
The IUPAC name of N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine (CID 81465823) is N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine.
What is the SMILES notation for N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine?
The canonical SMILES for N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine is CC1CC(Nc2cnn(C)c2)CN1C.
What is the InChIKey of N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine?
The InChIKey is FFZMEVRTWVDJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-8-4-9(6-13(8)2)12-10-5-11-14(3)7-10/h5,7-9,12H,4,6H2,1-3H3.
What are the key properties of N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine?
N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine has a molecular weight of 194.28 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,5-dimethylpyrrolidin-3-yl)-1-methylpyrazol-4-amine is sourced from PubChem (CID 81465823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).