About 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide
2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide (PubChem CID 81466039) has the molecular formula C8H19N3O2S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide |
| PubChem CID | 81466039 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide |
| SMILES | CC1CC(NCCS(N)(=O)=O)CN1C |
| InChI | InChI=1S/C8H19N3O2S/c1-7-5-8(6-11(7)2)10-3-4-14(9,12)13/h7-8,10H,3-6H2,1-2H3,(H2,9,12,13) |
| InChIKey | FXURZJCWQRWCFE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide?
The IUPAC name of 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide (CID 81466039) is 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide.
What is the SMILES notation for 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide?
The canonical SMILES for 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide is CC1CC(NCCS(N)(=O)=O)CN1C.
What is the InChIKey of 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide?
The InChIKey is FXURZJCWQRWCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3O2S/c1-7-5-8(6-11(7)2)10-3-4-14(9,12)13/h7-8,10H,3-6H2,1-2H3,(H2,9,12,13).
What are the key properties of 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide?
2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide has a molecular weight of 221.33 g/mol, XLogP of -1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethanesulfonamide is sourced from PubChem (CID 81466039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).