C13H17N3O2 — CID 81466348
5-[(1,5-dimethylpyrrolidin-3-yl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 81466348) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-[(1,5-dimethylpyrrolidin-3-yl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(1,5-dimethylpyrrolidin-3-yl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 81466348 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-[(1,5-dimethylpyrrolidin-3-yl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC1CC(Nc2ccc3oc(=O)[nH]c3c2)CN1C |
| InChI | InChI=1S/C13H17N3O2/c1-8-5-10(7-16(8)2)14-9-3-4-12-11(6-9)15-13(17)18-12/h3-4,6,8,10,14H,5,7H2,1-2H3,(H,15,17) |
| InChIKey | GEGIDNZYEUUWFH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |