C12H15F2NO — CID 81466414
1-(2,6-difluorophenyl)-2-pyrrolidin-2-ylethanol (PubChem CID 81466414) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-pyrrolidin-2-ylethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-pyrrolidin-2-ylethanol |
|---|---|
| PubChem CID | 81466414 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-pyrrolidin-2-ylethanol |
| SMILES | OC(CC1CCCN1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2NO/c13-9-4-1-5-10(14)12(9)11(16)7-8-3-2-6-15-8/h1,4-5,8,11,15-16H,2-3,6-7H2 |
| InChIKey | SDLAIEDWWXRDNA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |