About 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide
4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 814667) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 814667 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C13H16N4O/c1-13(2,3)11-6-4-10(5-7-11)12(18)16-17-8-14-15-9-17/h4-9H,1-3H3,(H,16,18) |
| InChIKey | ZRJMLTLTACZQTJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide (CID 814667) is 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide is CC(C)(C)c1ccc(C(=O)Nn2cnnc2)cc1.
What is the InChIKey of 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is ZRJMLTLTACZQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-13(2,3)11-6-4-10(5-7-11)12(18)16-17-8-14-15-9-17/h4-9H,1-3H3,(H,16,18).
What are the key properties of 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide?
4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 244.30 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 814667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).