About 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide
4-fluoro-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 814674) has the molecular formula C9H7FN4O
and a molecular weight of 206.18 g/mol. Its IUPAC name is 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 814674 |
| Molecular Formula | C9H7FN4O |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(Nn1cnnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FN4O/c10-8-3-1-7(2-4-8)9(15)13-14-5-11-12-6-14/h1-6H,(H,13,15) |
| InChIKey | QNLTTXQVAMGCIV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide (CID 814674) is 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide is O=C(Nn1cnnc1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is QNLTTXQVAMGCIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN4O/c10-8-3-1-7(2-4-8)9(15)13-14-5-11-12-6-14/h1-6H,(H,13,15).
What are the key properties of 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide?
4-fluoro-N-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 206.18 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 814674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).