About 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one
7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one (PubChem CID 81467554) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one.
Molecular Properties
| Compound Name | 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
| PubChem CID | 81467554 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
| SMILES | CC1CC2(COC(=O)N2)CN1C |
| InChI | InChI=1S/C8H14N2O2/c1-6-3-8(4-10(6)2)5-12-7(11)9-8/h6H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | XRVKTEWBQOBQAP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one?
The IUPAC name of 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one (CID 81467554) is 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one.
What is the SMILES notation for 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one?
The canonical SMILES for 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one is CC1CC2(COC(=O)N2)CN1C.
What is the InChIKey of 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one?
The InChIKey is XRVKTEWBQOBQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6-3-8(4-10(6)2)5-12-7(11)9-8/h6H,3-5H2,1-2H3,(H,9,11).
What are the key properties of 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one?
7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one has a molecular weight of 170.21 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one is sourced from PubChem (CID 81467554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).