About 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione
7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione (PubChem CID 81468530) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione.
Molecular Properties
| Compound Name | 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione |
| PubChem CID | 81468530 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione |
| SMILES | CC1CC2(CC(=O)OC2=O)CN1C |
| InChI | InChI=1S/C9H13NO3/c1-6-3-9(5-10(6)2)4-7(11)13-8(9)12/h6H,3-5H2,1-2H3 |
| InChIKey | ZNWLKBWEGUIPIO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione?
The IUPAC name of 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione (CID 81468530) is 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione.
What is the SMILES notation for 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione?
The canonical SMILES for 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione is CC1CC2(CC(=O)OC2=O)CN1C.
What is the InChIKey of 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione?
The InChIKey is ZNWLKBWEGUIPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-6-3-9(5-10(6)2)4-7(11)13-8(9)12/h6H,3-5H2,1-2H3.
What are the key properties of 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione?
7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione has a molecular weight of 183.21 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-2-oxa-7-azaspiro[4.4]nonane-1,3-dione is sourced from PubChem (CID 81468530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).