C9H15NO — CID 81468643
1,5-dimethyl-3-prop-2-ynylpyrrolidin-3-ol (PubChem CID 81468643) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1,5-dimethyl-3-prop-2-ynylpyrrolidin-3-ol.
| Compound Name | 1,5-dimethyl-3-prop-2-ynylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 81468643 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1,5-dimethyl-3-prop-2-ynylpyrrolidin-3-ol |
| SMILES | C#CCC1(O)CC(C)N(C)C1 |
| InChI | InChI=1S/C9H15NO/c1-4-5-9(11)6-8(2)10(3)7-9/h1,8,11H,5-7H2,2-3H3 |
| InChIKey | NINHWHHWSCXOBW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|