C14H26N4OS — CID 81469102
1-[5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 81469102) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-[5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-[5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81469102 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[5-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | COCCNCc1cnc(N2CC(C)C(N(C)C)C2)s1 |
| InChI | InChI=1S/C14H26N4OS/c1-11-9-18(10-13(11)17(2)3)14-16-8-12(20-14)7-15-5-6-19-4/h8,11,13,15H,5-7,9-10H2,1-4H3 |
| InChIKey | LKCUDLZOALETHT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|