C15H25N5 — CID 81469286
2-cyclopropyl-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N-methylpyrimidin-4-amine (PubChem CID 81469286) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-cyclopropyl-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N-methylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81469286 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-cyclopropyl-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(N2CC(C)C(N(C)C)C2)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H25N5/c1-10-8-20(9-12(10)19(3)4)14-7-13(16-2)17-15(18-14)11-5-6-11/h7,10-12H,5-6,8-9H2,1-4H3,(H,16,17,18) |
| InChIKey | QZEZTCJMBCXCHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |