C14H8Br4F2 — CID 81470322
1,4-dibromo-2-[bromo-(4-bromo-2,6-difluorophenyl)methyl]-5-methylbenzene (PubChem CID 81470322) has the molecular formula C14H8Br4F2 and a molecular weight of 533.83 g/mol. Its IUPAC name is 1,4-dibromo-2-[bromo-(4-bromo-2,6-difluorophenyl)methyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[bromo-(4-bromo-2,6-difluorophenyl)methyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81470322 |
| Molecular Formula | C14H8Br4F2 |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 529.73 |
| IUPAC Name | 1,4-dibromo-2-[bromo-(4-bromo-2,6-difluorophenyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Br)c2c(F)cc(Br)cc2F)cc1Br |
| InChI | InChI=1S/C14H8Br4F2/c1-6-2-10(17)8(5-9(6)16)14(18)13-11(19)3-7(15)4-12(13)20/h2-5,14H,1H3 |
| InChIKey | DDAWWYXTWFZTDN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|