C12H13Br3 — CID 81471013
1,4,5-tribromo-3-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 81471013) has the molecular formula C12H13Br3 and a molecular weight of 396.95 g/mol. Its IUPAC name is 1,4,5-tribromo-3-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 1,4,5-tribromo-3-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 81471013 |
| Molecular Formula | C12H13Br3 |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 393.86 |
| IUPAC Name | 1,4,5-tribromo-3-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Cc1cc(Br)c2c(c1Br)C(Br)CCCC2 |
| InChI | InChI=1S/C12H13Br3/c1-7-6-10(14)8-4-2-3-5-9(13)11(8)12(7)15/h6,9H,2-5H2,1H3 |
| InChIKey | ANRLXQHNTMBKAP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|