C10H15N3O2 — CID 81471254
4-methyl-N-piperidin-3-yl-1,3-oxazole-5-carboxamide (PubChem CID 81471254) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-methyl-N-piperidin-3-yl-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-piperidin-3-yl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 81471254 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-methyl-N-piperidin-3-yl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C10H15N3O2/c1-7-9(15-6-12-7)10(14)13-8-3-2-4-11-5-8/h6,8,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | APUHRIKMAGGXET-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |