C9H10BrN5 — CID 81472362
5-(3-bromo-4-methylphenyl)-1,2,4-triazole-3,4-diamine (PubChem CID 81472362) has the molecular formula C9H10BrN5 and a molecular weight of 268.12 g/mol. Its IUPAC name is 5-(3-bromo-4-methylphenyl)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-(3-bromo-4-methylphenyl)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 81472362 |
| Molecular Formula | C9H10BrN5 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 5-(3-bromo-4-methylphenyl)-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1ccc(-c2nnc(N)n2N)cc1Br |
| InChI | InChI=1S/C9H10BrN5/c1-5-2-3-6(4-7(5)10)8-13-14-9(11)15(8)12/h2-4H,12H2,1H3,(H2,11,14) |
| InChIKey | UTXJUNHYWCYTSV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |