C15H11Br2FO — CID 81473906
1-(2,5-dibromo-4-methylphenyl)-2-(4-fluorophenyl)ethanone (PubChem CID 81473906) has the molecular formula C15H11Br2FO and a molecular weight of 386.06 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 81473906 |
| Molecular Formula | C15H11Br2FO |
| Molecular Weight | 386.06 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)-2-(4-fluorophenyl)ethanone |
| SMILES | Cc1cc(Br)c(C(=O)Cc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C15H11Br2FO/c1-9-6-14(17)12(8-13(9)16)15(19)7-10-2-4-11(18)5-3-10/h2-6,8H,7H2,1H3 |
| InChIKey | PPJPYHLFSNCFME-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.06 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |