About [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone
[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 81474464) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone.
Molecular Properties
| Compound Name | [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
| PubChem CID | 81474464 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CCc1nc(C(=O)N2CC(C)C(N(C)C)C2)n[nH]1 |
| InChI | InChI=1S/C12H21N5O/c1-5-10-13-11(15-14-10)12(18)17-6-8(2)9(7-17)16(3)4/h8-9H,5-7H2,1-4H3,(H,13,14,15) |
| InChIKey | SLOGUBRIAMURQL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone?
The IUPAC name of [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone (CID 81474464) is [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone.
What is the SMILES notation for [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone?
The canonical SMILES for [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone is CCc1nc(C(=O)N2CC(C)C(N(C)C)C2)n[nH]1.
What is the InChIKey of [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone?
The InChIKey is SLOGUBRIAMURQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-5-10-13-11(15-14-10)12(18)17-6-8(2)9(7-17)16(3)4/h8-9H,5-7H2,1-4H3,(H,13,14,15).
What are the key properties of [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone?
[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone has a molecular weight of 251.33 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone is sourced from PubChem (CID 81474464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).