C14H10BrCl3 — CID 81476163
2-bromo-4-[chloro-(3,4-dichlorophenyl)methyl]-1-methylbenzene (PubChem CID 81476163) has the molecular formula C14H10BrCl3 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-bromo-4-[chloro-(3,4-dichlorophenyl)methyl]-1-methylbenzene.
| Compound Name | 2-bromo-4-[chloro-(3,4-dichlorophenyl)methyl]-1-methylbenzene |
|---|---|
| PubChem CID | 81476163 |
| Molecular Formula | C14H10BrCl3 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 2-bromo-4-[chloro-(3,4-dichlorophenyl)methyl]-1-methylbenzene |
| SMILES | Cc1ccc(C(Cl)c2ccc(Cl)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C14H10BrCl3/c1-8-2-3-9(6-11(8)15)14(18)10-4-5-12(16)13(17)7-10/h2-7,14H,1H3 |
| InChIKey | DKHMKJNCVWDFNJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|