C12H12BrFN2S — CID 81478264
2-(1-bromopropyl)-5-(2-fluoro-3-methylphenyl)-1,3,4-thiadiazole (PubChem CID 81478264) has the molecular formula C12H12BrFN2S and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-(2-fluoro-3-methylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-bromopropyl)-5-(2-fluoro-3-methylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 81478264 |
| Molecular Formula | C12H12BrFN2S |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-(1-bromopropyl)-5-(2-fluoro-3-methylphenyl)-1,3,4-thiadiazole |
| SMILES | CCC(Br)c1nnc(-c2cccc(C)c2F)s1 |
| InChI | InChI=1S/C12H12BrFN2S/c1-3-9(13)12-16-15-11(17-12)8-6-4-5-7(2)10(8)14/h4-6,9H,3H2,1-2H3 |
| InChIKey | KLPQBEFVYYHQFX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|