C17H19FN2OS — CID 814797
2-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 814797) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 814797 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(cyclopropylamino)-N-[(4-fluorophenyl)methyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CNC1CC1)N(Cc1ccc(F)cc1)Cc1cccs1 |
| InChI | InChI=1S/C17H19FN2OS/c18-14-5-3-13(4-6-14)11-20(12-16-2-1-9-22-16)17(21)10-19-15-7-8-15/h1-6,9,15,19H,7-8,10-12H2 |
| InChIKey | MGEKZZICPGKQBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |