C15H23NO2 — CID 81479748
9-butan-2-yl-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 81479748) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 9-butan-2-yl-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 9-butan-2-yl-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 81479748 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 9-butan-2-yl-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | CCC(C)c1cccc2c1OCCCC2NOC |
| InChI | InChI=1S/C15H23NO2/c1-4-11(2)12-7-5-8-13-14(16-17-3)9-6-10-18-15(12)13/h5,7-8,11,14,16H,4,6,9-10H2,1-3H3 |
| InChIKey | WQZZMGIODSJOGU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|