About 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one
3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one (PubChem CID 81480263) has the molecular formula C10H11ClN4O
and a molecular weight of 238.68 g/mol. Its IUPAC name is 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one |
| PubChem CID | 81480263 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one |
| SMILES | CC(N)c1n[nH]c(=O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C10H11ClN4O/c1-6(12)9-13-14-10(16)15(9)8-5-3-2-4-7(8)11/h2-6H,12H2,1H3,(H,14,16) |
| InChIKey | IQRDTWFUIADBTA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one (CID 81480263) is 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one is CC(N)c1n[nH]c(=O)n1-c1ccccc1Cl.
What is the InChIKey of 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one?
The InChIKey is IQRDTWFUIADBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN4O/c1-6(12)9-13-14-10(16)15(9)8-5-3-2-4-7(8)11/h2-6H,12H2,1H3,(H,14,16).
What are the key properties of 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one?
3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one has a molecular weight of 238.68 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminoethyl)-4-(2-chlorophenyl)-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 81480263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).