C15H24BrNO3S — CID 81480451
3-bromo-N-heptan-2-yl-5-(hydroxymethyl)-2-methylbenzenesulfonamide (PubChem CID 81480451) has the molecular formula C15H24BrNO3S and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-bromo-N-heptan-2-yl-5-(hydroxymethyl)-2-methylbenzenesulfonamide.
| Compound Name | 3-bromo-N-heptan-2-yl-5-(hydroxymethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81480451 |
| Molecular Formula | C15H24BrNO3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-bromo-N-heptan-2-yl-5-(hydroxymethyl)-2-methylbenzenesulfonamide |
| SMILES | CCCCCC(C)NS(=O)(=O)c1cc(CO)cc(Br)c1C |
| InChI | InChI=1S/C15H24BrNO3S/c1-4-5-6-7-11(2)17-21(19,20)15-9-13(10-18)8-14(16)12(15)3/h8-9,11,17-18H,4-7,10H2,1-3H3 |
| InChIKey | KIKIIXUUVQVUDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|