About 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride
3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride (PubChem CID 81481151) has the molecular formula C14H17ClFNO3S
and a molecular weight of 333.81 g/mol. Its IUPAC name is 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride |
| PubChem CID | 81481151 |
| Molecular Formula | C14H17ClFNO3S |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C(=O)N2CCC(C)(C)C2)c1F |
| InChI | InChI=1S/C14H17ClFNO3S/c1-9-6-10(21(15,19)20)7-11(12(9)16)13(18)17-5-4-14(2,3)8-17/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | POPHAPSFGPHJFM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride?
The IUPAC name of 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride (CID 81481151) is 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride.
What is the SMILES notation for 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride?
The canonical SMILES for 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride is Cc1cc(S(=O)(=O)Cl)cc(C(=O)N2CCC(C)(C)C2)c1F.
What is the InChIKey of 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride?
The InChIKey is POPHAPSFGPHJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClFNO3S/c1-9-6-10(21(15,19)20)7-11(12(9)16)13(18)17-5-4-14(2,3)8-17/h6-7H,4-5,8H2,1-3H3.
What are the key properties of 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride?
3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride has a molecular weight of 333.81 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylpyrrolidine-1-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride is sourced from PubChem (CID 81481151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).