About 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine
5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 81482097) has the molecular formula C13H18ClNO2
and a molecular weight of 255.74 g/mol. Its IUPAC name is 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 81482097 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCC1Oc2cc(C)c(Cl)c(C)c2C1NOC |
| InChI | InChI=1S/C13H18ClNO2/c1-5-9-13(15-16-4)11-8(3)12(14)7(2)6-10(11)17-9/h6,9,13,15H,5H2,1-4H3 |
| InChIKey | FBCWLMMAJYNHJR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine (CID 81482097) is 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine is CCC1Oc2cc(C)c(Cl)c(C)c2C1NOC.
What is the InChIKey of 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is FBCWLMMAJYNHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO2/c1-5-9-13(15-16-4)11-8(3)12(14)7(2)6-10(11)17-9/h6,9,13,15H,5H2,1-4H3.
What are the key properties of 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine?
5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 255.74 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-ethyl-N-methoxy-4,6-dimethyl-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 81482097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).