About N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide
N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 81482751) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 81482751 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NCC(C)(C)N)no1 |
| InChI | InChI=1S/C10H17N3O3/c1-10(2,11)6-12-9(14)8-4-7(5-15-3)16-13-8/h4H,5-6,11H2,1-3H3,(H,12,14) |
| InChIKey | NDECVHQSAGUOAV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (CID 81482751) is N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide is COCc1cc(C(=O)NCC(C)(C)N)no1.
What is the InChIKey of N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is NDECVHQSAGUOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-10(2,11)6-12-9(14)8-4-7(5-15-3)16-13-8/h4H,5-6,11H2,1-3H3,(H,12,14).
What are the key properties of N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 227.26 g/mol, XLogP of 0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-methylpropyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 81482751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).