C13H26N2O — CID 81485320
(Z)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpent-2-enamide (PubChem CID 81485320) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (Z)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpent-2-enamide.
| Compound Name | (Z)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 81485320 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (Z)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NC(C)(CN)CC(C)C |
| InChI | InChI=1S/C13H26N2O/c1-6-7-11(4)12(16)15-13(5,9-14)8-10(2)3/h7,10H,6,8-9,14H2,1-5H3,(H,15,16)/b11-7- |
| InChIKey | GAYXSVRIIWERGZ-XFFZJAGNSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|