C17H19N3O — CID 81485558
3-pyridin-2-yl-N-(1,2,3,4-tetrahydroquinolin-6-yl)propanamide (PubChem CID 81485558) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-pyridin-2-yl-N-(1,2,3,4-tetrahydroquinolin-6-yl)propanamide.
| Compound Name | 3-pyridin-2-yl-N-(1,2,3,4-tetrahydroquinolin-6-yl)propanamide |
|---|---|
| PubChem CID | 81485558 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-pyridin-2-yl-N-(1,2,3,4-tetrahydroquinolin-6-yl)propanamide |
| SMILES | O=C(CCc1ccccn1)Nc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C17H19N3O/c21-17(9-7-14-5-1-2-10-18-14)20-15-6-8-16-13(12-15)4-3-11-19-16/h1-2,5-6,8,10,12,19H,3-4,7,9,11H2,(H,20,21) |
| InChIKey | HUQIPLZCYHUPFB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |