C17H25BrN2O — CID 81486868
3-bromo-N-[2-(cycloheptylamino)ethyl]-2-methylbenzamide (PubChem CID 81486868) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 3-bromo-N-[2-(cycloheptylamino)ethyl]-2-methylbenzamide.
| Compound Name | 3-bromo-N-[2-(cycloheptylamino)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 81486868 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-bromo-N-[2-(cycloheptylamino)ethyl]-2-methylbenzamide |
| SMILES | Cc1c(Br)cccc1C(=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C17H25BrN2O/c1-13-15(9-6-10-16(13)18)17(21)20-12-11-19-14-7-4-2-3-5-8-14/h6,9-10,14,19H,2-5,7-8,11-12H2,1H3,(H,20,21) |
| InChIKey | VWOBPFPERVLSNA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|