C14H19N3O4 — CID 81487374
[2-(1-aminoethyl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 81487374) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [2-(1-aminoethyl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [2-(1-aminoethyl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 81487374 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-(1-aminoethyl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCOC(C(C)N)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O4/c1-9-3-4-11(7-12(9)17(19)20)14(18)16-5-6-21-13(8-16)10(2)15/h3-4,7,10,13H,5-6,8,15H2,1-2H3 |
| InChIKey | VIQMGPVEVNMGGE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|