About 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one
3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 81488522) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 81488522 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(CN)n[nH]c1=O |
| InChI | InChI=1S/C6H12N4O/c1-4(2)10-5(3-7)8-9-6(10)11/h4H,3,7H2,1-2H3,(H,9,11) |
| InChIKey | SFUBNWLNIHYGNF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one (CID 81488522) is 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one is CC(C)n1c(CN)n[nH]c1=O.
What is the InChIKey of 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The InChIKey is SFUBNWLNIHYGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-4(2)10-5(3-7)8-9-6(10)11/h4H,3,7H2,1-2H3,(H,9,11).
What are the key properties of 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one?
3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one has a molecular weight of 156.19 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4-propan-2-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 81488522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).