C8H16F2N2O — CID 81489680
2-amino-N-(2,2-difluoroethyl)-3-methylpentanamide (PubChem CID 81489680) has the molecular formula C8H16F2N2O and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-3-methylpentanamide.
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 81489680 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NCC(F)F |
| InChI | InChI=1S/C8H16F2N2O/c1-3-5(2)7(11)8(13)12-4-6(9)10/h5-7H,3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | MJVHPZJKCDUOJX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |