About 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one
3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one (PubChem CID 81489730) has the molecular formula C11H22N2OS
and a molecular weight of 230.38 g/mol. Its IUPAC name is 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 81489730 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC1CN(C(=O)C(C)(C)CN)CC(C)S1 |
| InChI | InChI=1S/C11H22N2OS/c1-8-5-13(6-9(2)15-8)10(14)11(3,4)7-12/h8-9H,5-7,12H2,1-4H3 |
| InChIKey | XMWXAQVNRLLPMO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one (CID 81489730) is 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one is CC1CN(C(=O)C(C)(C)CN)CC(C)S1.
What is the InChIKey of 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one?
The InChIKey is XMWXAQVNRLLPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2OS/c1-8-5-13(6-9(2)15-8)10(14)11(3,4)7-12/h8-9H,5-7,12H2,1-4H3.
What are the key properties of 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one?
3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one has a molecular weight of 230.38 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,6-dimethylthiomorpholin-4-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 81489730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).