C15H20F2N2 — CID 81491116
3-[1-(2,4-difluorophenyl)ethyl]-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 81491116) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-[1-(2,4-difluorophenyl)ethyl]-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-[1-(2,4-difluorophenyl)ethyl]-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 81491116 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-[1-(2,4-difluorophenyl)ethyl]-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CC(c1ccc(F)cc1F)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C15H20F2N2/c1-10(14-5-2-11(16)8-15(14)17)19-7-6-12-3-4-13(9-19)18-12/h2,5,8,10,12-13,18H,3-4,6-7,9H2,1H3 |
| InChIKey | KRQLGEAQADKHMM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |