C14H16Cl2O3 — CID 81491684
tert-butyl 3-(3,4-dichlorophenyl)-2-methyl-3-oxopropanoate (PubChem CID 81491684) has the molecular formula C14H16Cl2O3 and a molecular weight of 303.19 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dichlorophenyl)-2-methyl-3-oxopropanoate.
| Compound Name | tert-butyl 3-(3,4-dichlorophenyl)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 81491684 |
| Molecular Formula | C14H16Cl2O3 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | tert-butyl 3-(3,4-dichlorophenyl)-2-methyl-3-oxopropanoate |
| SMILES | CC(C(=O)OC(C)(C)C)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2O3/c1-8(13(18)19-14(2,3)4)12(17)9-5-6-10(15)11(16)7-9/h5-8H,1-4H3 |
| InChIKey | WNFJLSFBZRACDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|