About N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine
N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine (PubChem CID 81493193) has the molecular formula C8H14ClN3S
and a molecular weight of 219.74 g/mol. Its IUPAC name is N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine |
| PubChem CID | 81493193 |
| Molecular Formula | C8H14ClN3S |
| Molecular Weight | 219.74 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C8H14ClN3S/c1-12(4-2-3-10)6-7-5-11-8(9)13-7/h5H,2-4,6,10H2,1H3 |
| InChIKey | BEHYQTPWCBOAOE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine (CID 81493193) is N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine is CN(CCCN)Cc1cnc(Cl)s1.
What is the InChIKey of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine?
The InChIKey is BEHYQTPWCBOAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3S/c1-12(4-2-3-10)6-7-5-11-8(9)13-7/h5H,2-4,6,10H2,1H3.
What are the key properties of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine?
N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine has a molecular weight of 219.74 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 81493193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).