C13H18N6O2 — CID 81494171
ethyl 1-[2-amino-6-(propylamino)pyrimidin-4-yl]pyrazole-4-carboxylate (PubChem CID 81494171) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is ethyl 1-[2-amino-6-(propylamino)pyrimidin-4-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[2-amino-6-(propylamino)pyrimidin-4-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 81494171 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl 1-[2-amino-6-(propylamino)pyrimidin-4-yl]pyrazole-4-carboxylate |
| SMILES | CCCNc1cc(-n2cc(C(=O)OCC)cn2)nc(N)n1 |
| InChI | InChI=1S/C13H18N6O2/c1-3-5-15-10-6-11(18-13(14)17-10)19-8-9(7-16-19)12(20)21-4-2/h6-8H,3-5H2,1-2H3,(H3,14,15,17,18) |
| InChIKey | AOUSBXSMQODKIQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |