About 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid
2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid (PubChem CID 81495370) has the molecular formula C10H10BrNO3
and a molecular weight of 272.10 g/mol. Its IUPAC name is 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid |
| PubChem CID | 81495370 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1CNc2cccc(Br)c2O1 |
| InChI | InChI=1S/C10H10BrNO3/c11-7-2-1-3-8-10(7)15-6(5-12-8)4-9(13)14/h1-3,6,12H,4-5H2,(H,13,14) |
| InChIKey | VIWPKXOJEIVSDQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The IUPAC name of 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid (CID 81495370) is 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid.
What is the SMILES notation for 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The canonical SMILES for 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid is O=C(O)CC1CNc2cccc(Br)c2O1.
What is the InChIKey of 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
The InChIKey is VIWPKXOJEIVSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO3/c11-7-2-1-3-8-10(7)15-6(5-12-8)4-9(13)14/h1-3,6,12H,4-5H2,(H,13,14).
What are the key properties of 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid?
2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid has a molecular weight of 272.10 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid is sourced from PubChem (CID 81495370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).