C13H7Cl2FN2O2S — CID 81495404
6-(2,4-dichloro-5-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 81495404) has the molecular formula C13H7Cl2FN2O2S and a molecular weight of 345.18 g/mol. Its IUPAC name is 6-(2,4-dichloro-5-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
| Compound Name | 6-(2,4-dichloro-5-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 81495404 |
| Molecular Formula | C13H7Cl2FN2O2S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 6-(2,4-dichloro-5-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2nc(-c3cc(F)c(Cl)cc3Cl)cn12 |
| InChI | InChI=1S/C13H7Cl2FN2O2S/c1-5-11(12(19)20)21-13-17-10(4-18(5)13)6-2-9(16)8(15)3-7(6)14/h2-4H,1H3,(H,19,20) |
| InChIKey | LDVNZZXSRUZKQK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|