C16H16BrNO3 — CID 81496466
8-bromo-2-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 81496466) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 8-bromo-2-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 8-bromo-2-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 81496466 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 8-bromo-2-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COc1ccc(C2CNc3cccc(Br)c3O2)cc1OC |
| InChI | InChI=1S/C16H16BrNO3/c1-19-13-7-6-10(8-14(13)20-2)15-9-18-12-5-3-4-11(17)16(12)21-15/h3-8,15,18H,9H2,1-2H3 |
| InChIKey | XBOMQHSPOCRMJV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |