About 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one
2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 814967) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 814967 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | CCN1N=C(c2ccccc2)CCC1=O |
| InChI | InChI=1S/C12H14N2O/c1-2-14-12(15)9-8-11(13-14)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | QIUATXGHXBDLCK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one (CID 814967) is 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one is CCN1N=C(c2ccccc2)CCC1=O.
What is the InChIKey of 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one?
The InChIKey is QIUATXGHXBDLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-14-12(15)9-8-11(13-14)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one?
2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one has a molecular weight of 202.26 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-phenyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 814967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).