About methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate
methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate (PubChem CID 81497120) has the molecular formula C10H9F3N2O2S
and a molecular weight of 278.25 g/mol. Its IUPAC name is methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate |
| PubChem CID | 81497120 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate |
| SMILES | COC(=O)CCc1csc2nc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C10H9F3N2O2S/c1-17-8(16)3-2-6-5-18-9-14-7(4-15(6)9)10(11,12)13/h4-5H,2-3H2,1H3 |
| InChIKey | DVCRKISHQGEOQZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate?
The IUPAC name of methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate (CID 81497120) is methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate.
What is the SMILES notation for methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate?
The canonical SMILES for methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate is COC(=O)CCc1csc2nc(C(F)(F)F)cn12.
What is the InChIKey of methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate?
The InChIKey is DVCRKISHQGEOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O2S/c1-17-8(16)3-2-6-5-18-9-14-7(4-15(6)9)10(11,12)13/h4-5H,2-3H2,1H3.
What are the key properties of methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate?
methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate has a molecular weight of 278.25 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoate is sourced from PubChem (CID 81497120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).