C14H19ClFN3O2 — CID 81497379
2-[2-(1-aminoethyl)morpholin-4-yl]-N-(3-chloro-4-fluorophenyl)acetamide (PubChem CID 81497379) has the molecular formula C14H19ClFN3O2 and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-[2-(1-aminoethyl)morpholin-4-yl]-N-(3-chloro-4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-aminoethyl)morpholin-4-yl]-N-(3-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 81497379 |
| Molecular Formula | C14H19ClFN3O2 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-(1-aminoethyl)morpholin-4-yl]-N-(3-chloro-4-fluorophenyl)acetamide |
| SMILES | CC(N)C1CN(CC(=O)Nc2ccc(F)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C14H19ClFN3O2/c1-9(17)13-7-19(4-5-21-13)8-14(20)18-10-2-3-12(16)11(15)6-10/h2-3,6,9,13H,4-5,7-8,17H2,1H3,(H,18,20) |
| InChIKey | DJEFFGDKPGDJMQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |